CAS 263890-70-6 appears in our catalog under these names: GR148672X/ 99.78% (existing batch purity), GR148672X, GR148672X 99%, GR148672X, 99%, 99%, GR148672X, 99.58%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
1,1,1-trifluoro-4-hydroxy-3-[(3-methylphenyl)diazenyl]-4-thiophen-2-ylbut-3-en-2-one (CAS 263890-70-6) is a chemical compound with the molecular formula C15H11F3N2O2S and a molecular weight of 340.3 g/mol. IUPAC name: 1,1,1-trifluoro-4-hydroxy-3-[(3-methylphenyl)diazenyl]-4-thiophen-2-ylbut-3-en-2-one. InChIKey: OETQEFUTOKYBSL-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N2O2S |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 1,1,1-trifluoro-4-hydroxy-3-[(3-methylphenyl)diazenyl]-4-thiophen-2-ylbut-3-en-2-one |
| InChIKey | OETQEFUTOKYBSL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N=NC(=C(C2=CC=CS2)O)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)