Products 901245-65-6
CAS 901245-65-6 appears in our catalog under these names: GSK-5959/ 98.77% (existing batch purity), GSK 5959, GSK5959, GSK-5959, 95%, GSK-5959 99%. Offered by: TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5 mg.
N-(1,3-dimethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-2-methoxybenzamide (CAS 901245-65-6) is a chemical compound with the molecular formula C22H26N4O3 and a molecular weight of 394.5 g/mol. IUPAC name: N-(1,3-dimethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-2-methoxybenzamide. InChIKey: LTUGYAOMCKNTGG-UHFFFAOYSA-N.
| Molecular formula | C22H26N4O3 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | N-(1,3-dimethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-2-methoxybenzamide |
| InChIKey | LTUGYAOMCKNTGG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C(=C2)NC(=O)C3=CC=CC=C3OC)N4CCCCC4)N(C1=O)C |
Computed by PubChem (NCBI)