CAS 1150701-66-8 appears in our catalog under these names: GSK1940029/ 99.48% (existing batch purity), GSK1940029 (SCD inhibitor 1), GSK1940029, GSK1940029 99%, SCD inhibitor 1. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
1-[(3,4-dichlorophenyl)methyl]-N-[4-(hydroxymethyl)phenyl]-5-methyltriazole-4-carboxamide (CAS 1150701-66-8) is a chemical compound with the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.2 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methyl]-N-[4-(hydroxymethyl)phenyl]-5-methyltriazole-4-carboxamide. InChIKey: QQRGSFYTPBYCFD-UHFFFAOYSA-N.
| Molecular formula | C18H16Cl2N4O2 |
|---|---|
| Molecular weight | 391.2 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methyl]-N-[4-(hydroxymethyl)phenyl]-5-methyltriazole-4-carboxamide |
| InChIKey | QQRGSFYTPBYCFD-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1CC2=CC(=C(C=C2)Cl)Cl)C(=O)NC3=CC=C(C=C3)CO |
Computed by PubChem (NCBI)