CAS 2505498-73-5 appears in our catalog under these names: AR ligand-30, AR ligand-30, 95%. Offered by: MedChemExpress, Ambeed. Available pack sizes: Get quote, 50mg, 100mg, 250mg, 1g.
6-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyridazine-3-carboxamide (CAS 2505498-73-5) is a chemical compound with the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.2 g/mol. IUPAC name: 6-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyridazine-3-carboxamide. InChIKey: ZBLXGHCGQZWSTO-UHFFFAOYSA-N.
| Molecular formula | C18H16Cl2N4O2 |
|---|---|
| Molecular weight | 391.2 g/mol |
| IUPAC name | 6-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyridazine-3-carboxamide |
| InChIKey | ZBLXGHCGQZWSTO-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NC(=O)C2=NN=C(C=C2)Cl)OC3=CC(=C(C=C3)C#N)Cl |
Computed by PubChem (NCBI)