Products 380450-97-5
CAS 380450-97-5 appears in our catalog under these names: GSK3-IN-2/ 98.8% (existing batch purity), 3,7,7-Trimethyl-4-(thiophen-3-yl)-2,4,6,7,8,9-hexahydro-5H-pyrazolo[3,4-b]quinolin-5-one, 98%, 98%, GSK3-IN-2, 99.87%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 100 mg.
3,7,7-trimethyl-4-thiophen-3-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one (CAS 380450-97-5) is a chemical compound with the molecular formula C17H19N3OS and a molecular weight of 313.4 g/mol. IUPAC name: 3,7,7-trimethyl-4-thiophen-3-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one. InChIKey: BHLCWTAXFPUMBK-UHFFFAOYSA-N.
| Molecular formula | C17H19N3OS |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 3,7,7-trimethyl-4-thiophen-3-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
| InChIKey | BHLCWTAXFPUMBK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(C3=C(CC(CC3=O)(C)C)NC2=NN1)C4=CSC=C4 |
Computed by PubChem (NCBI)
Synonyms:
Oprea1_391598, orb1744311