Products 748145-19-9
CAS 748145-19-9 appears in our catalog under these names: GSK3-IN-4/ 97.1% (existing batch purity), 3,7,7-Trimethyl-4-(pyridin-3-yl)-2,4,6,7,8,9-hexahydro-5H-pyrazolo[3,4-b]quinolin-5-one, ≥98%, ≥98%, GSK3-IN-4. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
3,7,7-trimethyl-4-pyridin-3-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one (CAS 748145-19-9) is a chemical compound with the molecular formula C18H20N4O and a molecular weight of 308.4 g/mol. IUPAC name: 3,7,7-trimethyl-4-pyridin-3-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one. InChIKey: GKEYTFDKZJPLCV-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 3,7,7-trimethyl-4-pyridin-3-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
| InChIKey | GKEYTFDKZJPLCV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(C3=C(CC(CC3=O)(C)C)NC2=NN1)C4=CN=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
orb1685682, orb2900733