cas: 1622849-58-4 — see every product listed under this CAS number, including other names
GSK481, 99%, 99% (CAS 1622849-58-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABSA-1mg |
| cas | 1622849-58-4 |
| size | 1mg |
| availability | 0.2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 150.80 Pln | |
| Chemat | 5mg | 280.40 Pln | |
| Chemat | 10mg | 323.60 Pln | |
| Chemat | 25mg | 424.40 Pln | |
| Chemat | 50mg | 784.40 Pln | |
| Chemat | 100mg | 1355.60 Pln | |
| Chemat | 2mg | 198.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
5-benzyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2-oxazole-3-carboxamide (CAS 1622849-58-4) is a chemical compound with the molecular formula C21H19N3O4 and a molecular weight of 377.4 g/mol. IUPAC name: 5-benzyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2-oxazole-3-carboxamide. InChIKey: KNOUWGGQMADIBV-KRWDZBQOSA-N.
| Molecular formula | C21H19N3O4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 5-benzyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2-oxazole-3-carboxamide |
| InChIKey | KNOUWGGQMADIBV-KRWDZBQOSA-N |
| SMILES | CN1C2=CC=CC=C2OC[C@@H](C1=O)NC(=O)C3=NOC(=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)