Products 1622849-58-4
CAS 1622849-58-4 appears in our catalog under these names: Gsk481, 95%, GSK481/ 99.71% (existing batch purity), GSK481, GSK481 99%, GSK481, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 1mg, 5 mg.
5-benzyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2-oxazole-3-carboxamide (CAS 1622849-58-4) is a chemical compound with the molecular formula C21H19N3O4 and a molecular weight of 377.4 g/mol. IUPAC name: 5-benzyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2-oxazole-3-carboxamide. InChIKey: KNOUWGGQMADIBV-KRWDZBQOSA-N.
| Molecular formula | C21H19N3O4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 5-benzyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-1,2-oxazole-3-carboxamide |
| InChIKey | KNOUWGGQMADIBV-KRWDZBQOSA-N |
| SMILES | CN1C2=CC=CC=C2OC[C@@H](C1=O)NC(=O)C3=NOC(=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
orb1300407