CAS 2716217-79-5 appears in our catalog under these names: HDAC-IN-57, 98%, HDAC-IN-57/ 98.38% (existing batch purity), HDAC-IN-57. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
N-[[4-(hydroxycarbamoyl)phenyl]methyl]-2-(4-methoxyphenyl)pyridine-4-carboxamide (CAS 2716217-79-5) is a chemical compound with the molecular formula C21H19N3O4 and a molecular weight of 377.4 g/mol. IUPAC name: N-[[4-(hydroxycarbamoyl)phenyl]methyl]-2-(4-methoxyphenyl)pyridine-4-carboxamide. InChIKey: BOPYJZYHIIFOOS-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-2-(4-methoxyphenyl)pyridine-4-carboxamide |
| InChIKey | BOPYJZYHIIFOOS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC=CC(=C2)C(=O)NCC3=CC=C(C=C3)C(=O)NO |
Computed by PubChem (NCBI)