Gossypol (acetic acid), 99.75%
cas: 12542-36-8 — see every product listed under this CAS number, including other names
Gossypol (acetic acid), 99.75% (CAS 12542-36-8) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 500 mg, 100 mg, 10mM/1mL, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-17510-50 mg |
| cas | 12542-36-8 |
| size | 50 mg |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 263.96 Pln | |
| MedChemExpress | 500 mg | 839.82 Pln | |
| MedChemExpress | 100 mg | 361.49 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 1 g | 1271.71 Pln | |
| MedChemExpress | 5 g | 3575.14 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.75% |
Acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde (CAS 12542-36-8) is a chemical compound with the molecular formula C32H34O10 and a molecular weight of 578.6 g/mol. IUPAC name: acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde. InChIKey: NIOHNDKHQHVLKA-UHFFFAOYSA-N.
| Molecular formula | C32H34O10 |
|---|---|
| Molecular weight | 578.6 g/mol |
| IUPAC name | acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
| InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C(C(=C2C(C)C)O)O)C=O)C(=C1C3=C(C4=C(C=C3C)C(=C(C(=C4C=O)O)O)C(C)C)O)O.CC(=O)O |
Computed by PubChem (NCBI)