cas: 12542-36-8 — see every product listed under this CAS number, including other names
Gossypol Acetic Acid, >98.0%(T)(HPLC) (CAS 12542-36-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | G0543-250MG |
| cas | 12542-36-8 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 511.73 Pln | |
| TCI | 1g | 1455.84 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(HPLC) |
Acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde (CAS 12542-36-8) is a chemical compound with the molecular formula C32H34O10 and a molecular weight of 578.6 g/mol. IUPAC name: acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde. InChIKey: NIOHNDKHQHVLKA-UHFFFAOYSA-N.
| Molecular formula | C32H34O10 |
|---|---|
| Molecular weight | 578.6 g/mol |
| IUPAC name | acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
| InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C(C(=C2C(C)C)O)O)C=O)C(=C1C3=C(C4=C(C=C3C)C(=C(C(=C4C=O)O)O)C(C)C)O)O.CC(=O)O |
Computed by PubChem (NCBI)