cas: 12542-36-8 — see every product listed under this CAS number, including other names
Gossypol-acetic acid, 97.00% (CAS 12542-36-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM34310X-1g |
| cas | 12542-36-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1303.69 Pln | |
| Chemat | 250mg | 548.83 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.00% |
| category | Chemicals |
Acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde (CAS 12542-36-8) is a chemical compound with the molecular formula C32H34O10 and a molecular weight of 578.6 g/mol. IUPAC name: acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde. InChIKey: NIOHNDKHQHVLKA-UHFFFAOYSA-N.
| Molecular formula | C32H34O10 |
|---|---|
| Molecular weight | 578.6 g/mol |
| IUPAC name | acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
| InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C(C(=C2C(C)C)O)O)C=O)C(=C1C3=C(C4=C(C=C3C)C(=C(C(=C4C=O)O)O)C(C)C)O)O.CC(=O)O |
Computed by PubChem (NCBI)