CAS 80745-10-4 appears in our catalog under these names: H-Arg(Mtr)-OH, 97%, H–Arg(Mtr)–OH·1/2H2O, H-L-Arg(Mtr)-OH, H-Arg(Mtr)-OH 97%, H-Arg(Mtr)-OH, 98%, 98%. Offered by: AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 100g.
(2S)-2-amino-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoic acid (CAS 80745-10-4) is a chemical compound with the molecular formula C16H26N4O5S and a molecular weight of 386.5 g/mol. IUPAC name: (2S)-2-amino-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoic acid. InChIKey: FUSAEZSSVDNYPO-LBPRGKRZSA-N.
| Molecular formula | C16H26N4O5S |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | (2S)-2-amino-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]pentanoic acid |
| InChIKey | FUSAEZSSVDNYPO-LBPRGKRZSA-N |
| SMILES | CC1=CC(=C(C(=C1S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)N)N)C)C)OC |
Computed by PubChem (NCBI)