CAS 5678-45-5 appears in our catalog under these names: 3–Amino–3–(4–methoxyphenyl)propanoic acid, 3-Amino-3-(4-methoxyphenyl)propionic Acid, 3-Amino-3-(4-methoxyphenyl)propionic Acid, >98.0%(HPLC)(T), 3-Amino-3-(4-methoxyphenyl)propanoic acid, 97%, 97%, 3-Amino-3-(4-methoxyphenyl)propanoic acid, 97%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 0,25g, 2,5g, 1g, 250mg.
3-amino-3-(4-methoxyphenyl)propanoic acid (CAS 5678-45-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 3-amino-3-(4-methoxyphenyl)propanoic acid. InChIKey: NYTANCDDCQVQHG-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 3-amino-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | NYTANCDDCQVQHG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(CC(=O)O)N |
Computed by PubChem (NCBI)