cas: 387868-34-0 — see every product listed under this CAS number, including other names
H-Beta,beta-dimethyl-l-cys(pmeobzl)-oh, 95%, 95% (CAS 387868-34-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CHQM-100mg |
| cas | 387868-34-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 760.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid (CAS 387868-34-0) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid. InChIKey: UPOPBNWZZMNQAD-LLVKDONJSA-N.
| Molecular formula | C13H19NO3S |
|---|---|
| Molecular weight | 269.36 g/mol |
| IUPAC name | (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid |
| InChIKey | UPOPBNWZZMNQAD-LLVKDONJSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)N)SCC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)