CAS 53599-14-7 appears in our catalog under these names: H-Beta,beta-Dimethyl-D-Cys(pMeOBzl)-OH, 95%, (S)-2-Amino-3-((4-methoxybenzyl)thio)-3-methylbutanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
(2S)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid (CAS 53599-14-7) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: (2S)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid. InChIKey: UPOPBNWZZMNQAD-NSHDSACASA-N.
| Molecular formula | C13H19NO3S |
|---|---|
| Molecular weight | 269.36 g/mol |
| IUPAC name | (2S)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid |
| InChIKey | UPOPBNWZZMNQAD-NSHDSACASA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)SCC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)