CAS 387868-34-0 appears in our catalog under these names: H-Beta,beta-dimethyl-l-cys(pmeobzl)-oh, 95%, H-Pen(Mob)-OH 95%, H-Beta,beta-dimethyl-l-cys(pmeobzl)-oh, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
(2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid (CAS 387868-34-0) is a chemical compound with the molecular formula C13H19NO3S and a molecular weight of 269.36 g/mol. IUPAC name: (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid. InChIKey: UPOPBNWZZMNQAD-LLVKDONJSA-N.
| Molecular formula | C13H19NO3S |
|---|---|
| Molecular weight | 269.36 g/mol |
| IUPAC name | (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methylbutanoic acid |
| InChIKey | UPOPBNWZZMNQAD-LLVKDONJSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)N)SCC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)