cas: 28798-28-9 — see every product listed under this CAS number, including other names
H-Cys(Acm)-OH HCl, 98% (CAS 28798-28-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch113WJ9-250mg |
| cas | 28798-28-9 |
| size | 250mg |
| availability | 94.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 549.20 Pln | |
| Chemat | 25g | 923.60 Pln | |
| Chemat | 50g | 1739.60 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 980.79 Pln | |
| BLDpharm | 25g | 3807.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride (CAS 28798-28-9) is a chemical compound with the molecular formula C6H13ClN2O3S and a molecular weight of 228.70 g/mol. IUPAC name: (2R)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride. InChIKey: SZWPOAKLKGUXDD-JEDNCBNOSA-N.
| Molecular formula | C6H13ClN2O3S |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | (2R)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride |
| InChIKey | SZWPOAKLKGUXDD-JEDNCBNOSA-N |
| SMILES | CC(=O)NCSC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)