CAS 1171437-18-5 is the registry number for 2-Amino-N-(1,1-dioxidotetrahydrothiophen-3-yl)acetamide hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-amino-N-(1,1-dioxothiolan-3-yl)acetamide;hydrochloride (CAS 1171437-18-5) is a chemical compound with the molecular formula C6H13ClN2O3S and a molecular weight of 228.70 g/mol. IUPAC name: 2-amino-N-(1,1-dioxothiolan-3-yl)acetamide;hydrochloride. InChIKey: VEVKEBOWCHDWIQ-UHFFFAOYSA-N.
| Molecular formula | C6H13ClN2O3S |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | 2-amino-N-(1,1-dioxothiolan-3-yl)acetamide;hydrochloride |
| InChIKey | VEVKEBOWCHDWIQ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NC(=O)CN.Cl |
Computed by PubChem (NCBI)