CAS 200352-41-6 appears in our catalog under these names: H-D-Cys(acm)-oh hydrochloride, 95%, H–D–Cys(Acm)–OH · HCl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g.
(2S)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride (CAS 200352-41-6) is a chemical compound with the molecular formula C6H13ClN2O3S and a molecular weight of 228.70 g/mol. IUPAC name: (2S)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride. InChIKey: SZWPOAKLKGUXDD-NUBCRITNSA-N.
| Molecular formula | C6H13ClN2O3S |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | (2S)-3-(acetamidomethylsulfanyl)-2-aminopropanoic acid;hydrochloride |
| InChIKey | SZWPOAKLKGUXDD-NUBCRITNSA-N |
| SMILES | CC(=O)NCSC[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)