CAS 96193-68-9 appears in our catalog under these names: (2R)-2-amino-6-(2,2,2- trifluoroacetamido)hexanoic acid, 98%, 98%, N6-(2,2,2-Trifluoroacetyl)-D-lysine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 96193-68-9) is a chemical compound with the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. IUPAC name: (2R)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: PZZHRSVBHRVIMI-RXMQYKEDSA-N.
| Molecular formula | C8H13F3N2O3 |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | (2R)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| InChIKey | PZZHRSVBHRVIMI-RXMQYKEDSA-N |
| SMILES | C(CCNC(=O)C(F)(F)F)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)