CAS 1390655-06-7 is the registry number for 2-Methyl-1,4-diazepan-5-one trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-methyl-1,4-diazepan-5-one;2,2,2-trifluoroacetic acid (CAS 1390655-06-7) is a chemical compound with the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. IUPAC name: 2-methyl-1,4-diazepan-5-one;2,2,2-trifluoroacetic acid. InChIKey: PAAILCXIFILUQW-UHFFFAOYSA-N.
| Molecular formula | C8H13F3N2O3 |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | 2-methyl-1,4-diazepan-5-one;2,2,2-trifluoroacetic acid |
| InChIKey | PAAILCXIFILUQW-UHFFFAOYSA-N |
| SMILES | CC1CNC(=O)CCN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)