Products 1390655-06-7

CAS 1390655-06-7 is the registry number for 2-Methyl-1,4-diazepan-5-one trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-methyl-1,4-diazepan-5-one;2,2,2-trifluoroacetic acid (CAS 1390655-06-7) is a chemical compound with the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. IUPAC name: 2-methyl-1,4-diazepan-5-one;2,2,2-trifluoroacetic acid. InChIKey: PAAILCXIFILUQW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13F3N2O3
Molecular weight242.20 g/mol
IUPAC name2-methyl-1,4-diazepan-5-one;2,2,2-trifluoroacetic acid
InChIKeyPAAILCXIFILUQW-UHFFFAOYSA-N
SMILESCC1CNC(=O)CCN1.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)