Products 21761-08-0

CAS 21761-08-0 is the registry number for Lisinopril Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 21761-08-0) is a chemical compound with the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. IUPAC name: (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: KNCHTBNNSQSLRV-YFKPBYRVSA-N.

Identity
Molecular formulaC8H13F3N2O3
Molecular weight242.20 g/mol
IUPAC name(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid
InChIKeyKNCHTBNNSQSLRV-YFKPBYRVSA-N
SMILESC(CCN)C[C@@H](C(=O)O)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)