CAS 21761-08-0 is the registry number for Lisinopril Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 21761-08-0) is a chemical compound with the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. IUPAC name: (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: KNCHTBNNSQSLRV-YFKPBYRVSA-N.
| Molecular formula | C8H13F3N2O3 |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| InChIKey | KNCHTBNNSQSLRV-YFKPBYRVSA-N |
| SMILES | C(CCN)C[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)