H-ILE-PNA, 97%, 97%
cas: 70324-66-2 — see every product listed under this CAS number, including other names
H-ILE-PNA, 97%, 97% (CAS 70324-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1170PN-100mg |
| cas | 70324-66-2 |
| size | 100mg |
| availability | 3g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1086.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-2-amino-3-methyl-N-(4-nitrophenyl)pentanamide (CAS 70324-66-2) is a chemical compound with the molecular formula C12H17N3O3 and a molecular weight of 251.28 g/mol. IUPAC name: (2S,3S)-2-amino-3-methyl-N-(4-nitrophenyl)pentanamide. InChIKey: NCCAUSZFESISCS-KWQFWETISA-N.
| Molecular formula | C12H17N3O3 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-methyl-N-(4-nitrophenyl)pentanamide |
| InChIKey | NCCAUSZFESISCS-KWQFWETISA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)