cas: 6366-70-7 — see every product listed under this CAS number, including other names
H-Lys(Z)-OBzl·HCl, 98% (CAS 6366-70-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A152058-1g |
| cas | 6366-70-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 286.94 Pln | |
| Ambeed | 100g | 509.44 Pln | |
| Ambeed | 500g | 2261.62 Pln | |
| Ambeed | 1kg | 3796.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[(2S)-1-oxo-6-[(2-phenylacetyl)oxyamino]-1-phenylmethoxyhexan-2-yl]azanium chloride (CAS 6366-70-7) is a chemical compound with the molecular formula C21H27ClN2O4 and a molecular weight of 406.9 g/mol. IUPAC name: [(2S)-1-oxo-6-[(2-phenylacetyl)oxyamino]-1-phenylmethoxyhexan-2-yl]azanium chloride. InChIKey: NWSFLBWTZZJOAF-FYZYNONXSA-N.
| Molecular formula | C21H27ClN2O4 |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | [(2S)-1-oxo-6-[(2-phenylacetyl)oxyamino]-1-phenylmethoxyhexan-2-yl]azanium chloride |
| InChIKey | NWSFLBWTZZJOAF-FYZYNONXSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)ONCCCC[C@@H](C(=O)OCC2=CC=CC=C2)[NH3+].[Cl-] |
Computed by PubChem (NCBI)