CAS 6366-70-7 appears in our catalog under these names: N6-Carbobenzyloxy-L-lysine Benzyl Ester Hydrochloride, H–Lys(Z)–OBzl·HCl, H-L-Lys(Z)-OBzl*HCl, H-Lys(Z)-OBzl·HCl 98%, H-Lys(Z)-OBzl.HCl, 98%, 98%. Offered by: TRC, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 2g, 500mg, 100g, 5g, 25g, 10g, 500g.
[(2S)-1-oxo-6-[(2-phenylacetyl)oxyamino]-1-phenylmethoxyhexan-2-yl]azanium chloride (CAS 6366-70-7) is a chemical compound with the molecular formula C21H27ClN2O4 and a molecular weight of 406.9 g/mol. IUPAC name: [(2S)-1-oxo-6-[(2-phenylacetyl)oxyamino]-1-phenylmethoxyhexan-2-yl]azanium chloride. InChIKey: NWSFLBWTZZJOAF-FYZYNONXSA-N.
| Molecular formula | C21H27ClN2O4 |
|---|---|
| Molecular weight | 406.9 g/mol |
| IUPAC name | [(2S)-1-oxo-6-[(2-phenylacetyl)oxyamino]-1-phenylmethoxyhexan-2-yl]azanium chloride |
| InChIKey | NWSFLBWTZZJOAF-FYZYNONXSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)ONCCCC[C@@H](C(=O)OCC2=CC=CC=C2)[NH3+].[Cl-] |
Computed by PubChem (NCBI)