CAS 67336-19-0 appears in our catalog under these names: H–Phg(4–Cl)–OH, L-2-(4-Chlorophenyl)glycine, >98.0%(HPLC)(T), H-Phg(4-Cl)-Oh, 98%, 98%, H-Phg(4-Cl)-OH, 99.77%, L-4-Chlorophenylglycine, 98%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 100g, 5 g.
(2S)-2-amino-2-(4-chlorophenyl)acetic acid (CAS 67336-19-0) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: (2S)-2-amino-2-(4-chlorophenyl)acetic acid. InChIKey: QGJGBYXRJVIYGA-ZETCQYMHSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-chlorophenyl)acetic acid |
| InChIKey | QGJGBYXRJVIYGA-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)