CAS 43189-37-3 appears in our catalog under these names: H–D–Phg(4–Cl)–OH, H-D-Phg(4-Cl)-OH 95%, H-D-Phg(4-Cl)-OH, 95%, 95%, H-D-Phg(4-Cl)-OH, 99.86%, D-4-Chlorophenylglycine, 96%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100g, 500g, 10 g.
(2R)-2-amino-2-(4-chlorophenyl)acetic acid (CAS 43189-37-3) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: (2R)-2-amino-2-(4-chlorophenyl)acetic acid. InChIKey: QGJGBYXRJVIYGA-SSDOTTSWSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-chlorophenyl)acetic acid |
| InChIKey | QGJGBYXRJVIYGA-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)