CAS 75816-19-2 appears in our catalog under these names: 7-Bromo-l-tryptophan, 98%, 7-Bromo-L-tryptophan, 7-Bromo-L-Trytophan, 98%, 98%, 7-Bromo-L-tryptophan, min. 95 %, 25 mg, 7-Bromo-L-tryptophan, min. 95 %, 50 mg. Offered by: Combi-blocks, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 0,05g, 0,025g, 0,1g, 0,25g.
(2S)-2-amino-3-(7-bromo-1H-indol-3-yl)propanoic acid (CAS 75816-19-2) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2S)-2-amino-3-(7-bromo-1H-indol-3-yl)propanoic acid. InChIKey: VMMOOBBCGTVDGP-VIFPVBQESA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(7-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | VMMOOBBCGTVDGP-VIFPVBQESA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=C2C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)