CAS 33599-61-0 appears in our catalog under these names: 6-Bromo-dl-tryptophan, 97%, 2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic Acid, 2–Amino–3–(6–bromo–1H–indol–3–yl)propanoic acid, 6-Bromo-DL-tryptophan, 2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 0,5g, 2,5g.
2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid (CAS 33599-61-0) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid. InChIKey: OAORYCZPERQARS-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | OAORYCZPERQARS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C2CC(C(=O)O)N |
Computed by PubChem (NCBI)