cas: 131176-02-8 — see every product listed under this CAS number, including other names
H-trans-4-F-D-Pro-OH 97% (CAS 131176-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352801-100mg |
| cas | 131176-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 3029.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A352801 |
(2R,4S)-4-fluoropyrrolidine-2-carboxylic acid (CAS 131176-02-8) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (2R,4S)-4-fluoropyrrolidine-2-carboxylic acid. InChIKey: ZIWHMENIDGOELV-IUYQGCFVSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (2R,4S)-4-fluoropyrrolidine-2-carboxylic acid |
| InChIKey | ZIWHMENIDGOELV-IUYQGCFVSA-N |
| SMILES | C1[C@@H](CN[C@H]1C(=O)O)F |
Computed by PubChem (NCBI)