CAS 131176-02-8 appears in our catalog under these names: (2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid, 95%, Trans-4-fluoropyrrolidine-2-carboxylic acid hydrochloride, 95%, (2R,4S)–4–Fluoropyrrolidine–2–carboxylic acid, (2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid, H-trans-4-F-D-Pro-OH 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 2g, 100mg.
(2R,4S)-4-fluoropyrrolidine-2-carboxylic acid (CAS 131176-02-8) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (2R,4S)-4-fluoropyrrolidine-2-carboxylic acid. InChIKey: ZIWHMENIDGOELV-IUYQGCFVSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (2R,4S)-4-fluoropyrrolidine-2-carboxylic acid |
| InChIKey | ZIWHMENIDGOELV-IUYQGCFVSA-N |
| SMILES | C1[C@@H](CN[C@H]1C(=O)O)F |
Computed by PubChem (NCBI)