CAS 21156-44-5 appears in our catalog under these names: (2S,4R)-4-Fluoropyrrolidine-2-carboxylic acid hydrochloride, 95%, trans-4-Fluoropyrrolidine-2-carboxylic acid, 97%, trans-4-fluoropyrrolidine-2-carboxylic acid, 98%, 98%, (2S,4R)-4-F-Pro-OH, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
(2S,4R)-4-fluoropyrrolidine-2-carboxylic acid (CAS 21156-44-5) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (2S,4R)-4-fluoropyrrolidine-2-carboxylic acid. InChIKey: ZIWHMENIDGOELV-DMTCNVIQSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (2S,4R)-4-fluoropyrrolidine-2-carboxylic acid |
| InChIKey | ZIWHMENIDGOELV-DMTCNVIQSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)F |
Computed by PubChem (NCBI)