CAS 854847-61-3 appears in our catalog under these names: HLY78/ 99.58% (existing batch purity), HLY78, HLY78 99%, HLY78, 98%, 98%, HLY78, 98.44%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
4-ethyl-5-methyl-6H-[1,3]dioxolo[4,5-j]phenanthridine (CAS 854847-61-3) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: 4-ethyl-5-methyl-6H-[1,3]dioxolo[4,5-j]phenanthridine. InChIKey: FAZZYPIBZBGQSH-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 4-ethyl-5-methyl-6H-[1,3]dioxolo[4,5-j]phenanthridine |
| InChIKey | FAZZYPIBZBGQSH-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C3=CC4=C(C=C3CN2C)OCO4 |
Computed by PubChem (NCBI)