CAS 1980848-48-3 appears in our catalog under these names: HNPMI/ 98.6% (existing batch purity), HNPMI, HNPMI, 99.57%, HNPMI, 98%, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
2-[2,3-dihydroindol-1-yl-(4-methylphenyl)methyl]-4-nitrophenol (CAS 1980848-48-3) is a chemical compound with the molecular formula C22H20N2O3 and a molecular weight of 360.4 g/mol. IUPAC name: 2-[2,3-dihydroindol-1-yl-(4-methylphenyl)methyl]-4-nitrophenol. InChIKey: IKCOFVYDHULPDI-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O3 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2-[2,3-dihydroindol-1-yl-(4-methylphenyl)methyl]-4-nitrophenol |
| InChIKey | IKCOFVYDHULPDI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=C(C=CC(=C2)[N+](=O)[O-])O)N3CCC4=CC=CC=C43 |
Computed by PubChem (NCBI)