cas: 162067-53-0 — see every product listed under this CAS number, including other names
Hexanoyl-L-carnitine (chloride) (CAS 162067-53-0) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg. Offered by: TargetMol, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T38233-5mg |
| cas | 162067-53-0 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 1176.01 Pln | |
| TargetMol | 10mg | 1920.04 Pln | |
| TargetMol | 25mg | 3035.81 Pln | |
| TargetMol | 50mg | 4915.17 Pln | |
| MedChemExpress | 1 mg | 886.26 Pln | |
| MedChemExpress | 5 mg | 2423.42 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
[(2R)-3-carboxy-2-hexanoyloxypropyl]-trimethylazanium chloride (CAS 162067-53-0) is a chemical compound with the molecular formula C13H26ClNO4 and a molecular weight of 295.80 g/mol. IUPAC name: [(2R)-3-carboxy-2-hexanoyloxypropyl]-trimethylazanium chloride. InChIKey: DTHGTKVOSRYXOK-RFVHGSKJSA-N.
| Molecular formula | C13H26ClNO4 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-hexanoyloxypropyl]-trimethylazanium chloride |
| InChIKey | DTHGTKVOSRYXOK-RFVHGSKJSA-N |
| SMILES | CCCCCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)