Products 1393093-63-4

CAS 1393093-63-4 is the registry number for N-Butyl-N-(3-chloropropyl)butan-1-amine xoxalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

N-butyl-N-(3-chloropropyl)butan-1-amine;oxalic acid (CAS 1393093-63-4) is a chemical compound with the molecular formula C13H26ClNO4 and a molecular weight of 295.80 g/mol. IUPAC name: N-butyl-N-(3-chloropropyl)butan-1-amine;oxalic acid. InChIKey: HGRBSLUPZPHIKR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H26ClNO4
Molecular weight295.80 g/mol
IUPAC nameN-butyl-N-(3-chloropropyl)butan-1-amine;oxalic acid
InChIKeyHGRBSLUPZPHIKR-UHFFFAOYSA-N
SMILESCCCCN(CCCC)CCCCl.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)