CAS 172793-31-6 appears in our catalog under these names: H–D–Glu(OtBu)–OtBu · HCl, D-Glutamic acid di-tert-butyl ester hydrochloride, (R)-Di-tert-butyl 2-aminopentanedioate hydrochloride, 98%, 98%, D-Glutamic acid di-tert-butyl ester hydr, ochloride, 10 g, D-Glutamic acid di-tert-butyl ester hydr, ochloride, 25 g. Offered by: GLPBio, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 250mg, 100g, 250g.
Ditert-butyl (2R)-2-aminopentanedioate;hydrochloride (CAS 172793-31-6) is a chemical compound with the molecular formula C13H26ClNO4 and a molecular weight of 295.80 g/mol. IUPAC name: ditert-butyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: LFEYMWCCUAOUKZ-SBSPUUFOSA-N.
| Molecular formula | C13H26ClNO4 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | ditert-butyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | LFEYMWCCUAOUKZ-SBSPUUFOSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)