cas: 1024006-03-8 — see every product listed under this CAS number, including other names
Hydrazine, (2,4,5-trifluorophenyl)-, hydrochloride (1:1), 95%, 95% (CAS 1024006-03-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118D1-100mg |
| cas | 1024006-03-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1130.00 Pln | |
| Chemat | 250mg | 1576.40 Pln | |
| Chemat | 1g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,4,5-trifluorophenyl)hydrazine;hydrochloride (CAS 1024006-03-8) is a chemical compound with the molecular formula C6H6ClF3N2 and a molecular weight of 198.57 g/mol. IUPAC name: (2,4,5-trifluorophenyl)hydrazine;hydrochloride. InChIKey: LBNDNZBABIMTRL-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | (2,4,5-trifluorophenyl)hydrazine;hydrochloride |
| InChIKey | LBNDNZBABIMTRL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)NN.Cl |
Computed by PubChem (NCBI)