CAS 1024006-03-8 appears in our catalog under these names: (2,4,5-Trifluorophenyl)hydrazine hydrochloride, Hydrazine, (2,4,5-trifluorophenyl)-, hydrochloride (1:1), 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 2,5g, 100mg, 1g.
(2,4,5-trifluorophenyl)hydrazine;hydrochloride (CAS 1024006-03-8) is a chemical compound with the molecular formula C6H6ClF3N2 and a molecular weight of 198.57 g/mol. IUPAC name: (2,4,5-trifluorophenyl)hydrazine;hydrochloride. InChIKey: LBNDNZBABIMTRL-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | (2,4,5-trifluorophenyl)hydrazine;hydrochloride |
| InChIKey | LBNDNZBABIMTRL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)NN.Cl |
Computed by PubChem (NCBI)