CAS 2044705-13-5 appears in our catalog under these names: 2–(Difluoromethyl)–5–fluoropyridin–4–amine hydrochloride, 2-(Difluoromethyl)-5-fluoropyridin-4-amine hydrochloride, 95%, 2-(Difluoromethyl)-5-fluoropyridin-4-amine hydrochloride, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
2-(difluoromethyl)-5-fluoropyridin-4-amine;hydrochloride (CAS 2044705-13-5) is a chemical compound with the molecular formula C6H6ClF3N2 and a molecular weight of 198.57 g/mol. IUPAC name: 2-(difluoromethyl)-5-fluoropyridin-4-amine;hydrochloride. InChIKey: IZVBQUUXSJHREC-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 2-(difluoromethyl)-5-fluoropyridin-4-amine;hydrochloride |
| InChIKey | IZVBQUUXSJHREC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)F)F)N.Cl |
Computed by PubChem (NCBI)