Hydrazine,[[3-(trifluoromethyl)phenyl]methyl]-,hydrochloride (1:2), 97%, 97%
cas: 1242339-95-2 — see every product listed under this CAS number, including other names
Hydrazine,[[3-(trifluoromethyl)phenyl]methyl]-,hydrochloride (1:2), 97%, 97% (CAS 1242339-95-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LQU-250mg |
| cas | 1242339-95-2 |
| size | 250mg |
| availability | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 500mg | 266.00 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1600.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride (CAS 1242339-95-2) is a chemical compound with the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.08 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride. InChIKey: NUKYOOXHNAWDOU-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride |
| InChIKey | NUKYOOXHNAWDOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CNN.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
{[3-(trifluoromethyl)phenyl]methyl}hydrazine dihydrochloride, ([3-(Trifluoromethyl)phenyl]methyl)hydrazine dihydrochloride, ((3-(Trifluoromethyl)phenyl)methyl)hydrazine dihydrochloride, (3-(Trifluoromethyl)benzyl)hydrazine dihydrochloride, 1-[3-(Trifluoromethyl)benzyl]hydrazine dihydrochloride, [3-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride, 3-Trifluoromethylbenzylhydrazine 2HCl, [3-(Trifluoromethyl)benzyl]hydrazine Dihydrochloride, 3-(Trifluoromethyl)benzylhydrazine dihydrochloride, 3-Trifluoromethylbenzylhydrazine diHCl