CAS 1349718-18-8 is the registry number for [4-(Trifluoromethyl)benzyl]hydrazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
[4-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride (CAS 1349718-18-8) is a chemical compound with the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.08 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride. InChIKey: VMFVUIMVZRDACD-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride |
| InChIKey | VMFVUIMVZRDACD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNN)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)