cas: 1242339-95-2 — see every product listed under this CAS number, including other names
1-[3-(Trifluoromethyl)benzyl]hydrazine dihydrochloride, 97% (CAS 1242339-95-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F476032-250MG |
| cas | 1242339-95-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 500mg | 414.46 Pln | |
| Fluorochem | 1g | 716.43 Pln | |
| Fluorochem | 5g | 2627.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride (CAS 1242339-95-2) is a chemical compound with the molecular formula C8H11Cl2F3N2 and a molecular weight of 263.08 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride. InChIKey: NUKYOOXHNAWDOU-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl]methylhydrazine;dihydrochloride |
| InChIKey | NUKYOOXHNAWDOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CNN.Cl.Cl |
Computed by PubChem (NCBI)