cas: 1807530-05-7 — see every product listed under this CAS number, including other names
Hydroxy-PEG4-O-Boc, 97% (CAS 1807530-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554760-100MG |
| cas | 1807530-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 5g | 1658.81 Pln | |
| Fluorochem | 25g | 6500.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate (CAS 1807530-05-7) is a chemical compound with the molecular formula C16H32O8 and a molecular weight of 352.42 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate. InChIKey: XPLBSNFHNMATJJ-UHFFFAOYSA-N.
| Molecular formula | C16H32O8 |
|---|---|
| Molecular weight | 352.42 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | XPLBSNFHNMATJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)