CAS 1807530-05-7 appears in our catalog under these names: Hydroxy-PEG5-CH2CO2tBu, 95%, Hydroxy-PEG4-O-Boc, Hydroxy–PEG4–O–Boc, Hydroxy-PEG4-O-Boc 98%, Hydroxy-PEG5-t-butyl acetate, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 5mg, 10mg, 25mg, 50mg, 100mg.
Tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate (CAS 1807530-05-7) is a chemical compound with the molecular formula C16H32O8 and a molecular weight of 352.42 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate. InChIKey: XPLBSNFHNMATJJ-UHFFFAOYSA-N.
| Molecular formula | C16H32O8 |
|---|---|
| Molecular weight | 352.42 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | XPLBSNFHNMATJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)