cas: 1807530-05-7 — see every product listed under this CAS number, including other names
Hydroxy-PEG4-O-Boc (CAS 1807530-05-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T15533-5mg |
| cas | 1807530-05-7 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 386.15 Pln | |
| TargetMol | 10mg | 452.11 Pln | |
| TargetMol | 25mg | 598.57 Pln | |
| TargetMol | 50mg | 778.01 Pln | |
| TargetMol | 100mg | 1036.82 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
Tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate (CAS 1807530-05-7) is a chemical compound with the molecular formula C16H32O8 and a molecular weight of 352.42 g/mol. IUPAC name: tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate. InChIKey: XPLBSNFHNMATJJ-UHFFFAOYSA-N.
| Molecular formula | C16H32O8 |
|---|---|
| Molecular weight | 352.42 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | XPLBSNFHNMATJJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)