CAS 868145-09-9 appears in our catalog under these names: I942/ 99.75% (existing batch purity), I942, I942 99%, N-((2,4-dimethylphenyl)sulfonyl)-2-(naphthalen-2-yloxy)acetamide, 95%, 95%, I942, 99.38%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-(2,4-dimethylphenyl)sulfonyl-2-naphthalen-2-yloxyacetamide (CAS 868145-09-9) is a chemical compound with the molecular formula C20H19NO4S and a molecular weight of 369.4 g/mol. IUPAC name: N-(2,4-dimethylphenyl)sulfonyl-2-naphthalen-2-yloxyacetamide. InChIKey: KCRXXSQZEZOCFM-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)sulfonyl-2-naphthalen-2-yloxyacetamide |
| InChIKey | KCRXXSQZEZOCFM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)NC(=O)COC2=CC3=CC=CC=C3C=C2)C |
Computed by PubChem (NCBI)