CAS 866927-10-8 appears in our catalog under these names: IC87201, IC87201/ 97.44% (existing batch purity), 2-(((1H-Benzo[d][1,2,3]triazol-6-yl)amino)methyl)-4,6-dichlorophenol, IC87201, 97.24%, IC87201 (Standard). Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL, 50 mg.
2-[(2H-benzotriazol-5-ylamino)methyl]-4,6-dichlorophenol (CAS 866927-10-8) is a chemical compound with the molecular formula C13H10Cl2N4O and a molecular weight of 309.15 g/mol. IUPAC name: 2-[(2H-benzotriazol-5-ylamino)methyl]-4,6-dichlorophenol. InChIKey: QEHVTUCLCBXQIC-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N4O |
|---|---|
| Molecular weight | 309.15 g/mol |
| IUPAC name | 2-[(2H-benzotriazol-5-ylamino)methyl]-4,6-dichlorophenol |
| InChIKey | QEHVTUCLCBXQIC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNN=C2C=C1NCC3=C(C(=CC(=C3)Cl)Cl)O |
Computed by PubChem (NCBI)