CAS 582323-16-8 appears in our catalog under these names: ICA-069673/ 99.66% (existing batch purity), ICA 069673, ICA-069673, ICA 069673, 98%, 98%, ICA-069673, 99.20%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10mM (in 1ml dmso).
N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide (CAS 582323-16-8) is a chemical compound with the molecular formula C11H6ClF2N3O and a molecular weight of 269.63 g/mol. IUPAC name: N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide. InChIKey: IIBSHMFXVWTQSJ-UHFFFAOYSA-N.
| Molecular formula | C11H6ClF2N3O |
|---|---|
| Molecular weight | 269.63 g/mol |
| IUPAC name | N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide |
| InChIKey | IIBSHMFXVWTQSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NC2=CN=C(N=C2)Cl)F)F |
Computed by PubChem (NCBI)